C16H23ClN4O4 — CID 119504052
2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[2-(methylamino)ethyl]acetamide;hydrochloride (PubChem CID 119504052) has the molecular formula C16H23ClN4O4 and a molecular weight of 370.84 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[2-(methylamino)ethyl]acetamide;hydrochloride.
| Compound Name | 2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[2-(methylamino)ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119504052 |
| Molecular Formula | C16H23ClN4O4 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[2-(methylamino)ethyl]acetamide;hydrochloride |
| SMILES | CNCCNC(=O)CN1C(=O)NC(C)(c2ccc(OC)cc2)C1=O.Cl |
| InChI | InChI=1S/C16H22N4O4.ClH/c1-16(11-4-6-12(24-3)7-5-11)14(22)20(15(23)19-16)10-13(21)18-9-8-17-2;/h4-7,17H,8-10H2,1-3H3,(H,18,21)(H,19,23);1H |
| InChIKey | VYJIXHAUPWPINH-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|