C20H17N5O4 — CID 55418161
2-[4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(phenylcarbamoyl)acetamide (PubChem CID 55418161) has the molecular formula C20H17N5O4 and a molecular weight of 391.39 g/mol. Its IUPAC name is 2-[4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(phenylcarbamoyl)acetamide.
| Compound Name | 2-[4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(phenylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 55418161 |
| Molecular Formula | C20H17N5O4 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 2-[4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(phenylcarbamoyl)acetamide |
| SMILES | CC1(c2ccc(C#N)cc2)NC(=O)N(CC(=O)NC(=O)Nc2ccccc2)C1=O |
| InChI | InChI=1S/C20H17N5O4/c1-20(14-9-7-13(11-21)8-10-14)17(27)25(19(29)24-20)12-16(26)23-18(28)22-15-5-3-2-4-6-15/h2-10H,12H2,1H3,(H,24,29)(H2,22,23,26,28) |
| InChIKey | BUPWRSNDODLDTI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 131.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|