C20H15F3N4O3 — CID 18272609
2-[4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 18272609) has the molecular formula C20H15F3N4O3 and a molecular weight of 416.36 g/mol. Its IUPAC name is 2-[4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 18272609 |
| Molecular Formula | C20H15F3N4O3 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 2-[4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC1(c2ccc(C#N)cc2)NC(=O)N(CC(=O)Nc2ccc(C(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C20H15F3N4O3/c1-19(13-4-2-12(10-24)3-5-13)17(29)27(18(30)26-19)11-16(28)25-15-8-6-14(7-9-15)20(21,22)23/h2-9H,11H2,1H3,(H,25,28)(H,26,30) |
| InChIKey | CGVZIWSDKJRRMR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|