C25H19ClN4O4 — CID 51728735
N-[4-(2-chlorophenoxy)phenyl]-2-[(4R)-4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 51728735) has the molecular formula C25H19ClN4O4 and a molecular weight of 474.90 g/mol. Its IUPAC name is N-[4-(2-chlorophenoxy)phenyl]-2-[(4R)-4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[4-(2-chlorophenoxy)phenyl]-2-[(4R)-4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 51728735 |
| Molecular Formula | C25H19ClN4O4 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | N-[4-(2-chlorophenoxy)phenyl]-2-[(4R)-4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@]1(c2ccc(C#N)cc2)NC(=O)N(CC(=O)Nc2ccc(Oc3ccccc3Cl)cc2)C1=O |
| InChI | InChI=1S/C25H19ClN4O4/c1-25(17-8-6-16(14-27)7-9-17)23(32)30(24(33)29-25)15-22(31)28-18-10-12-19(13-11-18)34-21-5-3-2-4-20(21)26/h2-13H,15H2,1H3,(H,28,31)(H,29,33)/t25-/m1/s1 |
| InChIKey | YPCLLZZHWQFOAC-RUZDIDTESA-N |
| XLogP | 4.41 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|