C25H21F2N3O5 — CID 3965161
2-[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-phenoxyphenyl)acetamide (PubChem CID 3965161) has the molecular formula C25H21F2N3O5 and a molecular weight of 481.46 g/mol. Its IUPAC name is 2-[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3965161 |
| Molecular Formula | C25H21F2N3O5 |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 2-[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-phenoxyphenyl)acetamide |
| SMILES | CC1(c2ccc(OC(F)F)cc2)NC(=O)N(CC(=O)Nc2ccc(Oc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C25H21F2N3O5/c1-25(16-7-11-20(12-8-16)35-23(26)27)22(32)30(24(33)29-25)15-21(31)28-17-9-13-19(14-10-17)34-18-5-3-2-4-6-18/h2-14,23H,15H2,1H3,(H,28,31)(H,29,33) |
| InChIKey | VNBKMQNSYWVRPU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|