C19H18F2N4O6S — CID 4993844
2-[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 4993844) has the molecular formula C19H18F2N4O6S and a molecular weight of 468.44 g/mol. Its IUPAC name is 2-[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 4993844 |
| Molecular Formula | C19H18F2N4O6S |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 2-[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | CC1(c2ccc(OC(F)F)cc2)NC(=O)N(CC(=O)Nc2ccc(S(N)(=O)=O)cc2)C1=O |
| InChI | InChI=1S/C19H18F2N4O6S/c1-19(11-2-6-13(7-3-11)31-17(20)21)16(27)25(18(28)24-19)10-15(26)23-12-4-8-14(9-5-12)32(22,29)30/h2-9,17H,10H2,1H3,(H,23,26)(H,24,28)(H2,22,29,30) |
| InChIKey | VVONWOKEBXBMKU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|