C20H14ClF6N3O3 — CID 2491833
N-[3,5-bis(trifluoromethyl)phenyl]-2-[(4R)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 2491833) has the molecular formula C20H14ClF6N3O3 and a molecular weight of 493.79 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-2-[(4R)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-[(4R)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 2491833 |
| Molecular Formula | C20H14ClF6N3O3 |
| Molecular Weight | 493.79 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-[(4R)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@]1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C20H14ClF6N3O3/c1-18(10-2-4-13(21)5-3-10)16(32)30(17(33)29-18)9-15(31)28-14-7-11(19(22,23)24)6-12(8-14)20(25,26)27/h2-8H,9H2,1H3,(H,28,31)(H,29,33)/t18-/m1/s1 |
| InChIKey | WTPYYKWTOIROHW-GOSISDBHSA-N |
| XLogP | 4.78 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.79 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|