C22H23Cl2N3O3 — CID 2488720
2-[(4S)-4-(4-tert-butylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3,4-dichlorophenyl)acetamide (PubChem CID 2488720) has the molecular formula C22H23Cl2N3O3 and a molecular weight of 448.35 g/mol. Its IUPAC name is 2-[(4S)-4-(4-tert-butylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3,4-dichlorophenyl)acetamide.
| Compound Name | 2-[(4S)-4-(4-tert-butylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 2488720 |
| Molecular Formula | C22H23Cl2N3O3 |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 2-[(4S)-4-(4-tert-butylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3,4-dichlorophenyl)acetamide |
| SMILES | CC(C)(C)c1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3ccc(Cl)c(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C22H23Cl2N3O3/c1-21(2,3)13-5-7-14(8-6-13)22(4)19(29)27(20(30)26-22)12-18(28)25-15-9-10-16(23)17(24)11-15/h5-11H,12H2,1-4H3,(H,25,28)(H,26,30)/t22-/m0/s1 |
| InChIKey | RYJUMIJOQXHPFN-QFIPXVFZSA-N |
| XLogP | 4.70 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|