C19H16Cl2N4O5 — CID 46638683
2-[4-(3,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-methyl-3-nitrophenyl)acetamide (PubChem CID 46638683) has the molecular formula C19H16Cl2N4O5 and a molecular weight of 451.27 g/mol. Its IUPAC name is 2-[4-(3,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-methyl-3-nitrophenyl)acetamide.
| Compound Name | 2-[4-(3,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-methyl-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 46638683 |
| Molecular Formula | C19H16Cl2N4O5 |
| Molecular Weight | 451.27 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | 2-[4-(3,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-methyl-3-nitrophenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)NC(C)(c3ccc(Cl)c(Cl)c3)C2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16Cl2N4O5/c1-10-3-5-12(8-15(10)25(29)30)22-16(26)9-24-17(27)19(2,23-18(24)28)11-4-6-13(20)14(21)7-11/h3-8H,9H2,1-2H3,(H,22,26)(H,23,28) |
| InChIKey | UEGKKYFNKCWDNM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|