C18H13Cl2FN4O5 — CID 3873765
2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-fluoro-3-nitrophenyl)acetamide (PubChem CID 3873765) has the molecular formula C18H13Cl2FN4O5 and a molecular weight of 455.23 g/mol. Its IUPAC name is 2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-fluoro-3-nitrophenyl)acetamide.
| Compound Name | 2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-fluoro-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3873765 |
| Molecular Formula | C18H13Cl2FN4O5 |
| Molecular Weight | 455.23 g/mol |
| Exact Mass | 454.02 |
| IUPAC Name | 2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-fluoro-3-nitrophenyl)acetamide |
| SMILES | CC1(c2ccc(Cl)cc2Cl)NC(=O)N(CC(=O)Nc2ccc(F)c([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C18H13Cl2FN4O5/c1-18(11-4-2-9(19)6-12(11)20)16(27)24(17(28)23-18)8-15(26)22-10-3-5-13(21)14(7-10)25(29)30/h2-7H,8H2,1H3,(H,22,26)(H,23,28) |
| InChIKey | FXMSBMRLCVFZEK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.23 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|