C18H12Cl5N3O3 — CID 42982801
2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 42982801) has the molecular formula C18H12Cl5N3O3 and a molecular weight of 495.58 g/mol. Its IUPAC name is 2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 42982801 |
| Molecular Formula | C18H12Cl5N3O3 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 492.93 |
| IUPAC Name | 2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | CC1(c2ccc(Cl)cc2Cl)NC(=O)N(CC(=O)Nc2cc(Cl)c(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C18H12Cl5N3O3/c1-18(9-3-2-8(19)4-10(9)20)16(28)26(17(29)25-18)7-15(27)24-14-6-12(22)11(21)5-13(14)23/h2-6H,7H2,1H3,(H,24,27)(H,25,29) |
| InChIKey | OWGIDJNBSBFRHI-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|