C20H17Cl2N3O5 — CID 4803850
methyl 2-[[2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate (PubChem CID 4803850) has the molecular formula C20H17Cl2N3O5 and a molecular weight of 450.28 g/mol. Its IUPAC name is methyl 2-[[2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 4803850 |
| Molecular Formula | C20H17Cl2N3O5 |
| Molecular Weight | 450.28 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | methyl 2-[[2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CN1C(=O)NC(C)(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C20H17Cl2N3O5/c1-20(13-8-7-11(21)9-14(13)22)18(28)25(19(29)24-20)10-16(26)23-15-6-4-3-5-12(15)17(27)30-2/h3-9H,10H2,1-2H3,(H,23,26)(H,24,29) |
| InChIKey | ZJYOHTOJEOUUIS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|