C21H21Cl2N3O3 — CID 4804690
2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-ethyl-6-methylphenyl)acetamide (PubChem CID 4804690) has the molecular formula C21H21Cl2N3O3 and a molecular weight of 434.32 g/mol. Its IUPAC name is 2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-ethyl-6-methylphenyl)acetamide.
| Compound Name | 2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-ethyl-6-methylphenyl)acetamide |
|---|---|
| PubChem CID | 4804690 |
| Molecular Formula | C21H21Cl2N3O3 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-ethyl-6-methylphenyl)acetamide |
| SMILES | CCc1cccc(C)c1NC(=O)CN1C(=O)NC(C)(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C21H21Cl2N3O3/c1-4-13-7-5-6-12(2)18(13)24-17(27)11-26-19(28)21(3,25-20(26)29)15-9-8-14(22)10-16(15)23/h5-10H,4,11H2,1-3H3,(H,24,27)(H,25,29) |
| InChIKey | LIQHIRSVDXBHSR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|