C21H20Cl2N4O4 — CID 46641518
2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(2,3-dimethylphenyl)carbamoyl]acetamide (PubChem CID 46641518) has the molecular formula C21H20Cl2N4O4 and a molecular weight of 463.32 g/mol. Its IUPAC name is 2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(2,3-dimethylphenyl)carbamoyl]acetamide.
| Compound Name | 2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(2,3-dimethylphenyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 46641518 |
| Molecular Formula | C21H20Cl2N4O4 |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(2,3-dimethylphenyl)carbamoyl]acetamide |
| SMILES | Cc1cccc(NC(=O)NC(=O)CN2C(=O)NC(C)(c3ccc(Cl)cc3Cl)C2=O)c1C |
| InChI | InChI=1S/C21H20Cl2N4O4/c1-11-5-4-6-16(12(11)2)24-19(30)25-17(28)10-27-18(29)21(3,26-20(27)31)14-8-7-13(22)9-15(14)23/h4-9H,10H2,1-3H3,(H,26,31)(H2,24,25,28,30) |
| InChIKey | MAVAFZKUDOUTNF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|