C15H15Cl2N3O5 — CID 5138739
ethyl N-[2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]carbamate (PubChem CID 5138739) has the molecular formula C15H15Cl2N3O5 and a molecular weight of 388.21 g/mol. Its IUPAC name is ethyl N-[2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]carbamate.
| Compound Name | ethyl N-[2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]carbamate |
|---|---|
| PubChem CID | 5138739 |
| Molecular Formula | C15H15Cl2N3O5 |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | ethyl N-[2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)CN1C(=O)NC(C)(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C15H15Cl2N3O5/c1-3-25-14(24)18-11(21)7-20-12(22)15(2,19-13(20)23)9-5-4-8(16)6-10(9)17/h4-6H,3,7H2,1-2H3,(H,19,23)(H,18,21,24) |
| InChIKey | IUHXHPMPOUVEAB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|