C20H19Cl2N3O4 — CID 2703067
2-[(4S)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(4-methoxyphenyl)methyl]acetamide (PubChem CID 2703067) has the molecular formula C20H19Cl2N3O4 and a molecular weight of 436.30 g/mol. Its IUPAC name is 2-[(4S)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(4-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[(4S)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(4-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 2703067 |
| Molecular Formula | C20H19Cl2N3O4 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 2-[(4S)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(4-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)CN2C(=O)N[C@@](C)(c3ccc(Cl)cc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C20H19Cl2N3O4/c1-20(15-8-5-13(21)9-16(15)22)18(27)25(19(28)24-20)11-17(26)23-10-12-3-6-14(29-2)7-4-12/h3-9H,10-11H2,1-2H3,(H,23,26)(H,24,28)/t20-/m0/s1 |
| InChIKey | IUERZFQLRVANOS-FQEVSTJZSA-N |
| XLogP | 3.09 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|