C18H14Cl3N3O3 — CID 4966212
N-(2-chlorophenyl)-2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 4966212) has the molecular formula C18H14Cl3N3O3 and a molecular weight of 426.69 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 4966212 |
| Molecular Formula | C18H14Cl3N3O3 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | N-(2-chlorophenyl)-2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC1(c2ccc(Cl)cc2Cl)NC(=O)N(CC(=O)Nc2ccccc2Cl)C1=O |
| InChI | InChI=1S/C18H14Cl3N3O3/c1-18(11-7-6-10(19)8-13(11)21)16(26)24(17(27)23-18)9-15(25)22-14-5-3-2-4-12(14)20/h2-8H,9H2,1H3,(H,22,25)(H,23,27) |
| InChIKey | SLNHEQIGNHBQAU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|