C17H19Cl2N3O5 — CID 8570913
methyl 4-[[2-[(4R)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]butanoate (PubChem CID 8570913) has the molecular formula C17H19Cl2N3O5 and a molecular weight of 416.26 g/mol. Its IUPAC name is methyl 4-[[2-[(4R)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-[(4R)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 8570913 |
| Molecular Formula | C17H19Cl2N3O5 |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | methyl 4-[[2-[(4R)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)CN1C(=O)N[C@](C)(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C17H19Cl2N3O5/c1-17(11-6-5-10(18)8-12(11)19)15(25)22(16(26)21-17)9-13(23)20-7-3-4-14(24)27-2/h5-6,8H,3-4,7,9H2,1-2H3,(H,20,23)(H,21,26)/t17-/m1/s1 |
| InChIKey | OJCUZFLKMJPPLF-QGZVFWFLSA-N |
| XLogP | 1.83 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|