C15H16ClN3O5 — CID 2122537
methyl 2-[[2-[(4R)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]acetate (PubChem CID 2122537) has the molecular formula C15H16ClN3O5 and a molecular weight of 353.76 g/mol. Its IUPAC name is methyl 2-[[2-[(4R)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[(4R)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 2122537 |
| Molecular Formula | C15H16ClN3O5 |
| Molecular Weight | 353.76 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | methyl 2-[[2-[(4R)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)CN1C(=O)N[C@](C)(c2ccccc2Cl)C1=O |
| InChI | InChI=1S/C15H16ClN3O5/c1-15(9-5-3-4-6-10(9)16)13(22)19(14(23)18-15)8-11(20)17-7-12(21)24-2/h3-6H,7-8H2,1-2H3,(H,17,20)(H,18,23)/t15-/m1/s1 |
| InChIKey | XJUSFZBHBHYTJX-OAHLLOKOSA-N |
| XLogP | 0.40 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.76 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|