C20H19ClN4O4 — CID 2702151
N-(benzylcarbamoyl)-2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 2702151) has the molecular formula C20H19ClN4O4 and a molecular weight of 414.85 g/mol. Its IUPAC name is N-(benzylcarbamoyl)-2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(benzylcarbamoyl)-2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 2702151 |
| Molecular Formula | C20H19ClN4O4 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N-(benzylcarbamoyl)-2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@@]1(c2ccccc2Cl)NC(=O)N(CC(=O)NC(=O)NCc2ccccc2)C1=O |
| InChI | InChI=1S/C20H19ClN4O4/c1-20(14-9-5-6-10-15(14)21)17(27)25(19(29)24-20)12-16(26)23-18(28)22-11-13-7-3-2-4-8-13/h2-10H,11-12H2,1H3,(H,24,29)(H2,22,23,26,28)/t20-/m0/s1 |
| InChIKey | QNAXFXGCAADJCN-FQEVSTJZSA-N |
| XLogP | 2.13 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|