C18H17ClN4O5 — CID 2583031
2-[(4R)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(furan-2-ylmethylcarbamoyl)acetamide (PubChem CID 2583031) has the molecular formula C18H17ClN4O5 and a molecular weight of 404.81 g/mol. Its IUPAC name is 2-[(4R)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(furan-2-ylmethylcarbamoyl)acetamide.
| Compound Name | 2-[(4R)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(furan-2-ylmethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 2583031 |
| Molecular Formula | C18H17ClN4O5 |
| Molecular Weight | 404.81 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 2-[(4R)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(furan-2-ylmethylcarbamoyl)acetamide |
| SMILES | C[C@]1(c2ccccc2Cl)NC(=O)N(CC(=O)NC(=O)NCc2ccco2)C1=O |
| InChI | InChI=1S/C18H17ClN4O5/c1-18(12-6-2-3-7-13(12)19)15(25)23(17(27)22-18)10-14(24)21-16(26)20-9-11-5-4-8-28-11/h2-8H,9-10H2,1H3,(H,22,27)(H2,20,21,24,26)/t18-/m1/s1 |
| InChIKey | ZQTHLAXGHKVHOM-GOSISDBHSA-N |
| XLogP | 1.73 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.81 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|