C26H23ClN4O4 — CID 41236353
N-benzyl-2-[[2-[(4R)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide (PubChem CID 41236353) has the molecular formula C26H23ClN4O4 and a molecular weight of 490.95 g/mol. Its IUPAC name is N-benzyl-2-[[2-[(4R)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide.
| Compound Name | N-benzyl-2-[[2-[(4R)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 41236353 |
| Molecular Formula | C26H23ClN4O4 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | N-benzyl-2-[[2-[(4R)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide |
| SMILES | C[C@]1(c2ccccc2Cl)NC(=O)N(CC(=O)Nc2ccccc2C(=O)NCc2ccccc2)C1=O |
| InChI | InChI=1S/C26H23ClN4O4/c1-26(19-12-6-7-13-20(19)27)24(34)31(25(35)30-26)16-22(32)29-21-14-8-5-11-18(21)23(33)28-15-17-9-3-2-4-10-17/h2-14H,15-16H2,1H3,(H,28,33)(H,29,32)(H,30,35)/t26-/m1/s1 |
| InChIKey | RKNPJAXSIPHMOU-AREMUKBSSA-N |
| XLogP | 3.68 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|