C17H14Cl2N4O3 — CID 8011862
2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-chloro-3-pyridinyl)acetamide (PubChem CID 8011862) has the molecular formula C17H14Cl2N4O3 and a molecular weight of 393.23 g/mol. Its IUPAC name is 2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-chloro-3-pyridinyl)acetamide.
| Compound Name | 2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-chloro-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 8011862 |
| Molecular Formula | C17H14Cl2N4O3 |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-chloro-3-pyridinyl)acetamide |
| SMILES | C[C@@]1(c2ccccc2Cl)NC(=O)N(CC(=O)Nc2cccnc2Cl)C1=O |
| InChI | InChI=1S/C17H14Cl2N4O3/c1-17(10-5-2-3-6-11(10)18)15(25)23(16(26)22-17)9-13(24)21-12-7-4-8-20-14(12)19/h2-8H,9H2,1H3,(H,21,24)(H,22,26)/t17-/m0/s1 |
| InChIKey | VTQNSYGLHQVSEH-KRWDZBQOSA-N |
| XLogP | 2.79 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|