C17H13Cl3N4O3 — CID 46638569
N-(2-chloro-3-pyridinyl)-2-[4-(3,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 46638569) has the molecular formula C17H13Cl3N4O3 and a molecular weight of 427.68 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[4-(3,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[4-(3,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 46638569 |
| Molecular Formula | C17H13Cl3N4O3 |
| Molecular Weight | 427.68 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[4-(3,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC1(c2ccc(Cl)c(Cl)c2)NC(=O)N(CC(=O)Nc2cccnc2Cl)C1=O |
| InChI | InChI=1S/C17H13Cl3N4O3/c1-17(9-4-5-10(18)11(19)7-9)15(26)24(16(27)23-17)8-13(25)22-12-3-2-6-21-14(12)20/h2-7H,8H2,1H3,(H,22,25)(H,23,27) |
| InChIKey | IIISZWNRRPIYRA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.68 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|