C26H22F2N4O4 — CID 41197783
N-benzyl-2-[[2-[(4R)-4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide (PubChem CID 41197783) has the molecular formula C26H22F2N4O4 and a molecular weight of 492.48 g/mol. Its IUPAC name is N-benzyl-2-[[2-[(4R)-4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide.
| Compound Name | N-benzyl-2-[[2-[(4R)-4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 41197783 |
| Molecular Formula | C26H22F2N4O4 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | N-benzyl-2-[[2-[(4R)-4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide |
| SMILES | C[C@]1(c2ccc(F)c(F)c2)NC(=O)N(CC(=O)Nc2ccccc2C(=O)NCc2ccccc2)C1=O |
| InChI | InChI=1S/C26H22F2N4O4/c1-26(17-11-12-19(27)20(28)13-17)24(35)32(25(36)31-26)15-22(33)30-21-10-6-5-9-18(21)23(34)29-14-16-7-3-2-4-8-16/h2-13H,14-15H2,1H3,(H,29,34)(H,30,33)(H,31,36)/t26-/m1/s1 |
| InChIKey | LIRMQEPRRXXADQ-AREMUKBSSA-N |
| XLogP | 3.30 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|