C24H20F2N4O5 — CID 26009625
2-[[2-[(4R)-4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-N-(furan-2-ylmethyl)benzamide (PubChem CID 26009625) has the molecular formula C24H20F2N4O5 and a molecular weight of 482.44 g/mol. Its IUPAC name is 2-[[2-[(4R)-4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 2-[[2-[(4R)-4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 26009625 |
| Molecular Formula | C24H20F2N4O5 |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 2-[[2-[(4R)-4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-N-(furan-2-ylmethyl)benzamide |
| SMILES | C[C@]1(c2ccc(F)c(F)c2)NC(=O)N(CC(=O)Nc2ccccc2C(=O)NCc2ccco2)C1=O |
| InChI | InChI=1S/C24H20F2N4O5/c1-24(14-8-9-17(25)18(26)11-14)22(33)30(23(34)29-24)13-20(31)28-19-7-3-2-6-16(19)21(32)27-12-15-5-4-10-35-15/h2-11H,12-13H2,1H3,(H,27,32)(H,28,31)(H,29,34)/t24-/m1/s1 |
| InChIKey | XBFXIAVZSZWNPG-XMMPIXPASA-N |
| XLogP | 2.89 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|