C21H18F4N4O4 — CID 55516274
2-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 55516274) has the molecular formula C21H18F4N4O4 and a molecular weight of 466.39 g/mol. Its IUPAC name is 2-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 55516274 |
| Molecular Formula | C21H18F4N4O4 |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 2-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CC1(c2ccc(F)cc2)NC(=O)N(CC(=O)Nc2ccccc2C(=O)NCC(F)(F)F)C1=O |
| InChI | InChI=1S/C21H18F4N4O4/c1-20(12-6-8-13(22)9-7-12)18(32)29(19(33)28-20)10-16(30)27-15-5-3-2-4-14(15)17(31)26-11-21(23,24)25/h2-9H,10-11H2,1H3,(H,26,31)(H,27,30)(H,28,33) |
| InChIKey | DLHATXVDHYMMBH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|