C27H25FN4O4 — CID 41187564
N-benzyl-2-[[2-[(4S)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide (PubChem CID 41187564) has the molecular formula C27H25FN4O4 and a molecular weight of 488.52 g/mol. Its IUPAC name is N-benzyl-2-[[2-[(4S)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide.
| Compound Name | N-benzyl-2-[[2-[(4S)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 41187564 |
| Molecular Formula | C27H25FN4O4 |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-benzyl-2-[[2-[(4S)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide |
| SMILES | CC[C@@]1(c2ccc(F)cc2)NC(=O)N(CC(=O)Nc2ccccc2C(=O)NCc2ccccc2)C1=O |
| InChI | InChI=1S/C27H25FN4O4/c1-2-27(19-12-14-20(28)15-13-19)25(35)32(26(36)31-27)17-23(33)30-22-11-7-6-10-21(22)24(34)29-16-18-8-4-3-5-9-18/h3-15H,2,16-17H2,1H3,(H,29,34)(H,30,33)(H,31,36)/t27-/m0/s1 |
| InChIKey | GYERMJMWVBARCC-MHZLTWQESA-N |
| XLogP | 3.55 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|