C21H21F2N3O3 — CID 2117097
2-[(4S)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[2-(4-fluorophenyl)ethyl]acetamide (PubChem CID 2117097) has the molecular formula C21H21F2N3O3 and a molecular weight of 401.41 g/mol. Its IUPAC name is 2-[(4S)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[2-(4-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-[(4S)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[2-(4-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 2117097 |
| Molecular Formula | C21H21F2N3O3 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 2-[(4S)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[2-(4-fluorophenyl)ethyl]acetamide |
| SMILES | CC[C@@]1(c2ccc(F)cc2)NC(=O)N(CC(=O)NCCc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C21H21F2N3O3/c1-2-21(15-5-9-17(23)10-6-15)19(28)26(20(29)25-21)13-18(27)24-12-11-14-3-7-16(22)8-4-14/h3-10H,2,11-13H2,1H3,(H,24,27)(H,25,29)/t21-/m0/s1 |
| InChIKey | DBRJRIKYCBRRFY-NRFANRHFSA-N |
| XLogP | 2.48 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|