C21H24N4O5S — CID 41153699
2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 41153699) has the molecular formula C21H24N4O5S and a molecular weight of 444.51 g/mol. Its IUPAC name is 2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 41153699 |
| Molecular Formula | C21H24N4O5S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | CC[C@]1(c2ccccc2)NC(=O)N(CC(=O)NCCc2ccc(S(N)(=O)=O)cc2)C1=O |
| InChI | InChI=1S/C21H24N4O5S/c1-2-21(16-6-4-3-5-7-16)19(27)25(20(28)24-21)14-18(26)23-13-12-15-8-10-17(11-9-15)31(22,29)30/h3-11H,2,12-14H2,1H3,(H,23,26)(H,24,28)(H2,22,29,30)/t21-/m1/s1 |
| InChIKey | BSPLTXFLQHPZSO-OAQYLSRUSA-N |
| XLogP | 0.85 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|