C19H20N4O5S — CID 7179355
2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(3-sulfamoylphenyl)acetamide (PubChem CID 7179355) has the molecular formula C19H20N4O5S and a molecular weight of 416.46 g/mol. Its IUPAC name is 2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(3-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 7179355 |
| Molecular Formula | C19H20N4O5S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(3-sulfamoylphenyl)acetamide |
| SMILES | CC[C@@]1(c2ccccc2)NC(=O)N(CC(=O)Nc2cccc(S(N)(=O)=O)c2)C1=O |
| InChI | InChI=1S/C19H20N4O5S/c1-2-19(13-7-4-3-5-8-13)17(25)23(18(26)22-19)12-16(24)21-14-9-6-10-15(11-14)29(20,27)28/h3-11H,2,12H2,1H3,(H,21,24)(H,22,26)(H2,20,27,28)/t19-/m0/s1 |
| InChIKey | POYYGHMEBSXTMY-IBGZPJMESA-N |
| XLogP | 1.13 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|