C18H18N4O3 — CID 31541792
2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-pyridin-3-ylacetamide (PubChem CID 31541792) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-pyridin-3-ylacetamide.
| Compound Name | 2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 31541792 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-pyridin-3-ylacetamide |
| SMILES | CC[C@]1(c2ccccc2)NC(=O)N(CC(=O)Nc2cccnc2)C1=O |
| InChI | InChI=1S/C18H18N4O3/c1-2-18(13-7-4-3-5-8-13)16(24)22(17(25)21-18)12-15(23)20-14-9-6-10-19-11-14/h3-11H,2,12H2,1H3,(H,20,23)(H,21,25)/t18-/m1/s1 |
| InChIKey | SQEHFFAXCNXGMW-GOSISDBHSA-N |
| XLogP | 1.88 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|