C21H23N3O3 — CID 7242663
2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(3-ethylphenyl)acetamide (PubChem CID 7242663) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(3-ethylphenyl)acetamide.
| Compound Name | 2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(3-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 7242663 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(3-ethylphenyl)acetamide |
| SMILES | CCc1cccc(NC(=O)CN2C(=O)N[C@](CC)(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C21H23N3O3/c1-3-15-9-8-12-17(13-15)22-18(25)14-24-19(26)21(4-2,23-20(24)27)16-10-6-5-7-11-16/h5-13H,3-4,14H2,1-2H3,(H,22,25)(H,23,27)/t21-/m1/s1 |
| InChIKey | VAIDJFXGCIMWCW-OAQYLSRUSA-N |
| XLogP | 3.04 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|