C22H24N4O4 — CID 2582874
4-[[2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]amino]-N,N-dimethylbenzamide (PubChem CID 2582874) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 4-[[2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 4-[[2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 2582874 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 4-[[2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]amino]-N,N-dimethylbenzamide |
| SMILES | CC[C@]1(c2ccccc2)NC(=O)N(CC(=O)Nc2ccc(C(=O)N(C)C)cc2)C1=O |
| InChI | InChI=1S/C22H24N4O4/c1-4-22(16-8-6-5-7-9-16)20(29)26(21(30)24-22)14-18(27)23-17-12-10-15(11-13-17)19(28)25(2)3/h5-13H,4,14H2,1-3H3,(H,23,27)(H,24,30)/t22-/m1/s1 |
| InChIKey | LWGDPNZBWXYTOX-JOCHJYFZSA-N |
| XLogP | 2.18 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|