C23H26N4O5 — CID 55893836
3-[[2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]amino]-4-methoxy-N,N-dimethylbenzamide (PubChem CID 55893836) has the molecular formula C23H26N4O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is 3-[[2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]amino]-4-methoxy-N,N-dimethylbenzamide.
| Compound Name | 3-[[2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]amino]-4-methoxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 55893836 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 3-[[2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]amino]-4-methoxy-N,N-dimethylbenzamide |
| SMILES | CCC1(c2ccccc2)NC(=O)N(CC(=O)Nc2cc(C(=O)N(C)C)ccc2OC)C1=O |
| InChI | InChI=1S/C23H26N4O5/c1-5-23(16-9-7-6-8-10-16)21(30)27(22(31)25-23)14-19(28)24-17-13-15(20(29)26(2)3)11-12-18(17)32-4/h6-13H,5,14H2,1-4H3,(H,24,28)(H,25,31) |
| InChIKey | YCUJQVRGANITPF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|