C26H23N3O5 — CID 40940422
2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(2-methoxydibenzofuran-3-yl)acetamide (PubChem CID 40940422) has the molecular formula C26H23N3O5 and a molecular weight of 457.49 g/mol. Its IUPAC name is 2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(2-methoxydibenzofuran-3-yl)acetamide.
| Compound Name | 2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(2-methoxydibenzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 40940422 |
| Molecular Formula | C26H23N3O5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(2-methoxydibenzofuran-3-yl)acetamide |
| SMILES | CC[C@@]1(c2ccccc2)NC(=O)N(CC(=O)Nc2cc3oc4ccccc4c3cc2OC)C1=O |
| InChI | InChI=1S/C26H23N3O5/c1-3-26(16-9-5-4-6-10-16)24(31)29(25(32)28-26)15-23(30)27-19-14-21-18(13-22(19)33-2)17-11-7-8-12-20(17)34-21/h4-14H,3,15H2,1-2H3,(H,27,30)(H,28,32)/t26-/m0/s1 |
| InChIKey | UZFOPRNRFYPQLJ-SANMLTNESA-N |
| XLogP | 4.39 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|