C22H21N3O5 — CID 2711778
2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2-methoxydibenzofuran-3-yl)acetamide (PubChem CID 2711778) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2-methoxydibenzofuran-3-yl)acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2-methoxydibenzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 2711778 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2-methoxydibenzofuran-3-yl)acetamide |
| SMILES | COc1cc2c(cc1NC(=O)CN1C(=O)NC3(CCCC3)C1=O)oc1ccccc12 |
| InChI | InChI=1S/C22H21N3O5/c1-29-18-10-14-13-6-2-3-7-16(13)30-17(14)11-15(18)23-19(26)12-25-20(27)22(24-21(25)28)8-4-5-9-22/h2-3,6-7,10-11H,4-5,8-9,12H2,1H3,(H,23,26)(H,24,28) |
| InChIKey | GKEFQXCNJSJXMO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|