C26H23N3O6 — CID 41192882
N-(2-methoxydibenzofuran-3-yl)-2-[(4S)-4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 41192882) has the molecular formula C26H23N3O6 and a molecular weight of 473.49 g/mol. Its IUPAC name is N-(2-methoxydibenzofuran-3-yl)-2-[(4S)-4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2-methoxydibenzofuran-3-yl)-2-[(4S)-4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 41192882 |
| Molecular Formula | C26H23N3O6 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | N-(2-methoxydibenzofuran-3-yl)-2-[(4S)-4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | COc1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3cc4oc5ccccc5c4cc3OC)C2=O)cc1 |
| InChI | InChI=1S/C26H23N3O6/c1-26(15-8-10-16(33-2)11-9-15)24(31)29(25(32)28-26)14-23(30)27-19-13-21-18(12-22(19)34-3)17-6-4-5-7-20(17)35-21/h4-13H,14H2,1-3H3,(H,27,30)(H,28,32)/t26-/m0/s1 |
| InChIKey | HDJQPJQJGNGGPO-SANMLTNESA-N |
| XLogP | 4.01 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|