C23H20N2O5 — CID 7962349
2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2-methoxydibenzofuran-3-yl)acetamide (PubChem CID 7962349) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is 2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2-methoxydibenzofuran-3-yl)acetamide.
| Compound Name | 2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2-methoxydibenzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 7962349 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2-methoxydibenzofuran-3-yl)acetamide |
| SMILES | COc1cc2c(cc1NC(=O)CN1C(=O)[C@@H]3CC=CC[C@H]3C1=O)oc1ccccc12 |
| InChI | InChI=1S/C23H20N2O5/c1-29-20-10-16-13-6-4-5-9-18(13)30-19(16)11-17(20)24-21(26)12-25-22(27)14-7-2-3-8-15(14)23(25)28/h2-6,9-11,14-15H,7-8,12H2,1H3,(H,24,26)/t14-,15-/m1/s1 |
| InChIKey | VFZHFXRSKXVRPA-HUUCEWRRSA-N |
| XLogP | 3.48 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|