C23H25N3O7 — CID 16549652
methyl 2-[[2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]amino]-4,5-dimethoxybenzoate (PubChem CID 16549652) has the molecular formula C23H25N3O7 and a molecular weight of 455.47 g/mol. Its IUPAC name is methyl 2-[[2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]amino]-4,5-dimethoxybenzoate.
| Compound Name | methyl 2-[[2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]amino]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 16549652 |
| Molecular Formula | C23H25N3O7 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | methyl 2-[[2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]amino]-4,5-dimethoxybenzoate |
| SMILES | CCC1(c2ccccc2)NC(=O)N(CC(=O)Nc2cc(OC)c(OC)cc2C(=O)OC)C1=O |
| InChI | InChI=1S/C23H25N3O7/c1-5-23(14-9-7-6-8-10-14)21(29)26(22(30)25-23)13-19(27)24-16-12-18(32-3)17(31-2)11-15(16)20(28)33-4/h6-12H,5,13H2,1-4H3,(H,24,27)(H,25,30) |
| InChIKey | NEFYMNAEXXEEDQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|