C19H16F3N3O3 — CID 2582755
2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 2582755) has the molecular formula C19H16F3N3O3 and a molecular weight of 391.35 g/mol. Its IUPAC name is 2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 2582755 |
| Molecular Formula | C19H16F3N3O3 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CC[C@@]1(c2ccccc2)NC(=O)N(CC(=O)Nc2ccc(F)c(F)c2F)C1=O |
| InChI | InChI=1S/C19H16F3N3O3/c1-2-19(11-6-4-3-5-7-11)17(27)25(18(28)24-19)10-14(26)23-13-9-8-12(20)15(21)16(13)22/h3-9H,2,10H2,1H3,(H,23,26)(H,24,28)/t19-/m0/s1 |
| InChIKey | NRIQANWNOXKDDG-IBGZPJMESA-N |
| XLogP | 2.90 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|