C26H25N3O4 — CID 42986255
2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(2-methoxy-5-methylphenyl)acetamide (PubChem CID 42986255) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(2-methoxy-5-methylphenyl)acetamide.
| Compound Name | 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(2-methoxy-5-methylphenyl)acetamide |
|---|---|
| PubChem CID | 42986255 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(2-methoxy-5-methylphenyl)acetamide |
| SMILES | COc1ccc(C)cc1NC(=O)CN1C(=O)NC(Cc2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C26H25N3O4/c1-18-13-14-22(33-2)21(15-18)27-23(30)17-29-24(31)26(28-25(29)32,20-11-7-4-8-12-20)16-19-9-5-3-6-10-19/h3-15H,16-17H2,1-2H3,(H,27,30)(H,28,32) |
| InChIKey | YPSWGYWVJMZAAF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|