C26H25N3O3 — CID 40965115
2-[(4S)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(2,5-dimethylphenyl)acetamide (PubChem CID 40965115) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-[(4S)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(2,5-dimethylphenyl)acetamide.
| Compound Name | 2-[(4S)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 40965115 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 2-[(4S)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(2,5-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)CN2C(=O)N[C@@](Cc3ccccc3)(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C26H25N3O3/c1-18-13-14-19(2)22(15-18)27-23(30)17-29-24(31)26(28-25(29)32,21-11-7-4-8-12-21)16-20-9-5-3-6-10-20/h3-15H,16-17H2,1-2H3,(H,27,30)(H,28,32)/t26-/m0/s1 |
| InChIKey | TXXFAZIWRHXZCA-SANMLTNESA-N |
| XLogP | 3.93 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|