C24H20FN3O3 — CID 7637677
2-[(4R)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 7637677) has the molecular formula C24H20FN3O3 and a molecular weight of 417.44 g/mol. Its IUPAC name is 2-[(4R)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[(4R)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 7637677 |
| Molecular Formula | C24H20FN3O3 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-[(4R)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O)Nc1ccccc1F |
| InChI | InChI=1S/C24H20FN3O3/c25-19-13-7-8-14-20(19)26-21(29)16-28-22(30)24(27-23(28)31,18-11-5-2-6-12-18)15-17-9-3-1-4-10-17/h1-14H,15-16H2,(H,26,29)(H,27,31)/t24-/m1/s1 |
| InChIKey | JCEGELDRMDXEIV-XMMPIXPASA-N |
| XLogP | 3.45 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|