C25H23N3O3 — CID 16545157
2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(4-methylphenyl)acetamide (PubChem CID 16545157) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(4-methylphenyl)acetamide.
| Compound Name | 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 16545157 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)NC(Cc3ccccc3)(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C25H23N3O3/c1-18-12-14-21(15-13-18)26-22(29)17-28-23(30)25(27-24(28)31,20-10-6-3-7-11-20)16-19-8-4-2-5-9-19/h2-15H,16-17H2,1H3,(H,26,29)(H,27,31) |
| InChIKey | WKNVYQDVRQQAJL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|