C25H22N4O4 — CID 2705391
4-[[2-[(4S)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]amino]benzamide (PubChem CID 2705391) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is 4-[[2-[(4S)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[(4S)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 2705391 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 4-[[2-[(4S)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)CN2C(=O)N[C@@](Cc3ccccc3)(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C25H22N4O4/c26-22(31)18-11-13-20(14-12-18)27-21(30)16-29-23(32)25(28-24(29)33,19-9-5-2-6-10-19)15-17-7-3-1-4-8-17/h1-14H,15-16H2,(H2,26,31)(H,27,30)(H,28,33)/t25-/m0/s1 |
| InChIKey | JFIHHFIEALEZCM-VWLOTQADSA-N |
| XLogP | 2.41 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|