C23H26FN3O3 — CID 7622092
2-[(4R)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2,5-dimethylphenyl)acetamide (PubChem CID 7622092) has the molecular formula C23H26FN3O3 and a molecular weight of 411.48 g/mol. Its IUPAC name is 2-[(4R)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2,5-dimethylphenyl)acetamide.
| Compound Name | 2-[(4R)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 7622092 |
| Molecular Formula | C23H26FN3O3 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 2-[(4R)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2,5-dimethylphenyl)acetamide |
| SMILES | CCCC[C@]1(c2ccc(F)cc2)NC(=O)N(CC(=O)Nc2cc(C)ccc2C)C1=O |
| InChI | InChI=1S/C23H26FN3O3/c1-4-5-12-23(17-8-10-18(24)11-9-17)21(29)27(22(30)26-23)14-20(28)25-19-13-15(2)6-7-16(19)3/h6-11,13H,4-5,12,14H2,1-3H3,(H,25,28)(H,26,30)/t23-/m1/s1 |
| InChIKey | KXMHHWOSGQYBIY-HSZRJFAPSA-N |
| XLogP | 4.02 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|