C23H25ClFN3O5 — CID 24567519
2-[4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide (PubChem CID 24567519) has the molecular formula C23H25ClFN3O5 and a molecular weight of 477.92 g/mol. Its IUPAC name is 2-[4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 24567519 |
| Molecular Formula | C23H25ClFN3O5 |
| Molecular Weight | 477.92 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 2-[4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide |
| SMILES | CCCCC1(c2ccc(F)cc2)NC(=O)N(CC(=O)Nc2cc(Cl)c(OC)cc2OC)C1=O |
| InChI | InChI=1S/C23H25ClFN3O5/c1-4-5-10-23(14-6-8-15(25)9-7-14)21(30)28(22(31)27-23)13-20(29)26-17-11-16(24)18(32-2)12-19(17)33-3/h6-9,11-12H,4-5,10,13H2,1-3H3,(H,26,29)(H,27,31) |
| InChIKey | UNOXTAAROVQRMK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.92 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|