C18H22FN3O5 — CID 7621289
ethyl N-[2-[(4S)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]carbamate (PubChem CID 7621289) has the molecular formula C18H22FN3O5 and a molecular weight of 379.39 g/mol. Its IUPAC name is ethyl N-[2-[(4S)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]carbamate.
| Compound Name | ethyl N-[2-[(4S)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]carbamate |
|---|---|
| PubChem CID | 7621289 |
| Molecular Formula | C18H22FN3O5 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | ethyl N-[2-[(4S)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]carbamate |
| SMILES | CCCC[C@@]1(c2ccc(F)cc2)NC(=O)N(CC(=O)NC(=O)OCC)C1=O |
| InChI | InChI=1S/C18H22FN3O5/c1-3-5-10-18(12-6-8-13(19)9-7-12)15(24)22(16(25)21-18)11-14(23)20-17(26)27-4-2/h6-9H,3-5,10-11H2,1-2H3,(H,21,25)(H,20,23,26)/t18-/m0/s1 |
| InChIKey | CHVVLCVFNUDFFI-SFHVURJKSA-N |
| XLogP | 2.04 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|