C18H23FN4O4 — CID 7621326
2-[(4R)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(ethylcarbamoyl)acetamide (PubChem CID 7621326) has the molecular formula C18H23FN4O4 and a molecular weight of 378.40 g/mol. Its IUPAC name is 2-[(4R)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(ethylcarbamoyl)acetamide.
| Compound Name | 2-[(4R)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(ethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 7621326 |
| Molecular Formula | C18H23FN4O4 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 2-[(4R)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(ethylcarbamoyl)acetamide |
| SMILES | CCCC[C@]1(c2ccc(F)cc2)NC(=O)N(CC(=O)NC(=O)NCC)C1=O |
| InChI | InChI=1S/C18H23FN4O4/c1-3-5-10-18(12-6-8-13(19)9-7-12)15(25)23(17(27)22-18)11-14(24)21-16(26)20-4-2/h6-9H,3-5,10-11H2,1-2H3,(H,22,27)(H2,20,21,24,26)/t18-/m1/s1 |
| InChIKey | CYUXGMQQTATIMH-GOSISDBHSA-N |
| XLogP | 1.61 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|